C20H14FO2S+ — CID 171589717
methyl 5-(4-fluorophenyl)dibenzothiophen-5-ium-2-carboxylate (PubChem CID 171589717) has the molecular formula C20H14FO2S+ and a molecular weight of 337.40 g/mol. Its IUPAC name is methyl 5-(4-fluorophenyl)dibenzothiophen-5-ium-2-carboxylate.
| Compound Name | methyl 5-(4-fluorophenyl)dibenzothiophen-5-ium-2-carboxylate |
|---|---|
| PubChem CID | 171589717 |
| Molecular Formula | C20H14FO2S+ |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | methyl 5-(4-fluorophenyl)dibenzothiophen-5-ium-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1ccccc1[s+]2-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H14FO2S/c1-23-20(22)13-6-11-19-17(12-13)16-4-2-3-5-18(16)24(19)15-9-7-14(21)8-10-15/h2-12H,1H3/q+1 |
| InChIKey | COHZJZGVLMBXEU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|