C23H19O4S+ — CID 171589937
dimethyl 5-(4-methylphenyl)dibenzothiophen-5-ium-2,8-dicarboxylate (PubChem CID 171589937) has the molecular formula C23H19O4S+ and a molecular weight of 391.47 g/mol. Its IUPAC name is dimethyl 5-(4-methylphenyl)dibenzothiophen-5-ium-2,8-dicarboxylate.
| Compound Name | dimethyl 5-(4-methylphenyl)dibenzothiophen-5-ium-2,8-dicarboxylate |
|---|---|
| PubChem CID | 171589937 |
| Molecular Formula | C23H19O4S+ |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | dimethyl 5-(4-methylphenyl)dibenzothiophen-5-ium-2,8-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1cc(C(=O)OC)ccc1[s+]2-c1ccc(C)cc1 |
| InChI | InChI=1S/C23H19O4S/c1-14-4-8-17(9-5-14)28-20-10-6-15(22(24)26-2)12-18(20)19-13-16(23(25)27-3)7-11-21(19)28/h4-13H,1-3H3/q+1 |
| InChIKey | ZKVJRJGJEHASET-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|