C32H27O5S+ — CID 171589714
methyl 5-[4-[2-[(1-methyl-2,3-dihydroinden-1-yl)oxy]-2-oxoethoxy]phenyl]dibenzothiophen-5-ium-2-carboxylate (PubChem CID 171589714) has the molecular formula C32H27O5S+ and a molecular weight of 523.63 g/mol. Its IUPAC name is methyl 5-[4-[2-[(1-methyl-2,3-dihydroinden-1-yl)oxy]-2-oxoethoxy]phenyl]dibenzothiophen-5-ium-2-carboxylate.
| Compound Name | methyl 5-[4-[2-[(1-methyl-2,3-dihydroinden-1-yl)oxy]-2-oxoethoxy]phenyl]dibenzothiophen-5-ium-2-carboxylate |
|---|---|
| PubChem CID | 171589714 |
| Molecular Formula | C32H27O5S+ |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | methyl 5-[4-[2-[(1-methyl-2,3-dihydroinden-1-yl)oxy]-2-oxoethoxy]phenyl]dibenzothiophen-5-ium-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1ccccc1[s+]2-c1ccc(OCC(=O)OC2(C)CCc3ccccc32)cc1 |
| InChI | InChI=1S/C32H27O5S/c1-32(18-17-21-7-3-5-9-27(21)32)37-30(33)20-36-23-12-14-24(15-13-23)38-28-10-6-4-8-25(28)26-19-22(31(34)35-2)11-16-29(26)38/h3-16,19H,17-18,20H2,1-2H3/q+1 |
| InChIKey | JDEKSXLMSGWXGC-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|