C37H29O6S+ — CID 140655484
2-(5-oxo-2,2-diphenyl-1,3-dioxolan-4-yl)ethyl 2-(4-dibenzothiophen-5-ium-5-ylphenoxy)acetate (PubChem CID 140655484) has the molecular formula C37H29O6S+ and a molecular weight of 601.70 g/mol. Its IUPAC name is 2-(5-oxo-2,2-diphenyl-1,3-dioxolan-4-yl)ethyl 2-(4-dibenzothiophen-5-ium-5-ylphenoxy)acetate.
| Compound Name | 2-(5-oxo-2,2-diphenyl-1,3-dioxolan-4-yl)ethyl 2-(4-dibenzothiophen-5-ium-5-ylphenoxy)acetate |
|---|---|
| PubChem CID | 140655484 |
| Molecular Formula | C37H29O6S+ |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.17 |
| IUPAC Name | 2-(5-oxo-2,2-diphenyl-1,3-dioxolan-4-yl)ethyl 2-(4-dibenzothiophen-5-ium-5-ylphenoxy)acetate |
| SMILES | O=C(COc1ccc(-[s+]2c3ccccc3c3ccccc32)cc1)OCCC1OC(c2ccccc2)(c2ccccc2)OC1=O |
| InChI | InChI=1S/C37H29O6S/c38-35(40-24-23-32-36(39)43-37(42-32,26-11-3-1-4-12-26)27-13-5-2-6-14-27)25-41-28-19-21-29(22-20-28)44-33-17-9-7-15-30(33)31-16-8-10-18-34(31)44/h1-22,32H,23-25H2/q+1 |
| InChIKey | UBISDMXVJFFIFG-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|