C34H35O6S+ — CID 140655485
[4-[2-oxo-2-[2-(5-oxospiro[1,3-dioxolane-2,2'-adamantane]-4-yl)ethoxy]ethoxy]phenyl]-diphenylsulfanium (PubChem CID 140655485) has the molecular formula C34H35O6S+ and a molecular weight of 571.72 g/mol. Its IUPAC name is [4-[2-oxo-2-[2-(5-oxospiro[1,3-dioxolane-2,2'-adamantane]-4-yl)ethoxy]ethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[2-oxo-2-[2-(5-oxospiro[1,3-dioxolane-2,2'-adamantane]-4-yl)ethoxy]ethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 140655485 |
| Molecular Formula | C34H35O6S+ |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | [4-[2-oxo-2-[2-(5-oxospiro[1,3-dioxolane-2,2'-adamantane]-4-yl)ethoxy]ethoxy]phenyl]-diphenylsulfanium |
| SMILES | O=C(COc1ccc([S+](c2ccccc2)c2ccccc2)cc1)OCCC1OC2(OC1=O)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C34H35O6S/c35-32(37-16-15-31-33(36)40-34(39-31)25-18-23-17-24(20-25)21-26(34)19-23)22-38-27-11-13-30(14-12-27)41(28-7-3-1-4-8-28)29-9-5-2-6-10-29/h1-14,23-26,31H,15-22H2/q+1 |
| InChIKey | PBGDQGTZCVEWMW-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|