C33H33O5S+ — CID 140655491
[4-[2-(4-oxospiro[1,3-dioxane-2,2'-adamantane]-5-yl)acetyl]oxyphenyl]-diphenylsulfanium (PubChem CID 140655491) has the molecular formula C33H33O5S+ and a molecular weight of 541.69 g/mol. Its IUPAC name is [4-[2-(4-oxospiro[1,3-dioxane-2,2'-adamantane]-5-yl)acetyl]oxyphenyl]-diphenylsulfanium.
| Compound Name | [4-[2-(4-oxospiro[1,3-dioxane-2,2'-adamantane]-5-yl)acetyl]oxyphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 140655491 |
| Molecular Formula | C33H33O5S+ |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | [4-[2-(4-oxospiro[1,3-dioxane-2,2'-adamantane]-5-yl)acetyl]oxyphenyl]-diphenylsulfanium |
| SMILES | O=C(CC1COC2(OC1=O)C1CC3CC(C1)CC2C3)Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H33O5S/c34-31(20-24-21-36-33(38-32(24)35)25-16-22-15-23(18-25)19-26(33)17-22)37-27-11-13-30(14-12-27)39(28-7-3-1-4-8-28)29-9-5-2-6-10-29/h1-14,22-26H,15-21H2/q+1 |
| InChIKey | SVPNPAZBCVIDDC-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|