C30H31O2S+ — CID 59465064
[4-(adamantane-1-carbonyloxymethyl)phenyl]-diphenylsulfanium (PubChem CID 59465064) has the molecular formula C30H31O2S+ and a molecular weight of 455.64 g/mol. Its IUPAC name is [4-(adamantane-1-carbonyloxymethyl)phenyl]-diphenylsulfanium.
| Compound Name | [4-(adamantane-1-carbonyloxymethyl)phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 59465064 |
| Molecular Formula | C30H31O2S+ |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | [4-(adamantane-1-carbonyloxymethyl)phenyl]-diphenylsulfanium |
| SMILES | O=C(OCc1ccc([S+](c2ccccc2)c2ccccc2)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H31O2S/c31-29(30-18-23-15-24(19-30)17-25(16-23)20-30)32-21-22-11-13-28(14-12-22)33(26-7-3-1-4-8-26)27-9-5-2-6-10-27/h1-14,23-25H,15-21H2/q+1 |
| InChIKey | VKHDZVLVLGYVQU-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|