C33H33F2O8S2+ — CID 87180992
2,2-difluoro-2-[2-(4-oxoadamantane-1-carbonyl)oxyacetyl]oxyethanesulfonic acid;triphenylsulfanium (PubChem CID 87180992) has the molecular formula C33H33F2O8S2+ and a molecular weight of 659.75 g/mol. Its IUPAC name is 2,2-difluoro-2-[2-(4-oxoadamantane-1-carbonyl)oxyacetyl]oxyethanesulfonic acid;triphenylsulfanium.
| Compound Name | 2,2-difluoro-2-[2-(4-oxoadamantane-1-carbonyl)oxyacetyl]oxyethanesulfonic acid;triphenylsulfanium |
|---|---|
| PubChem CID | 87180992 |
| Molecular Formula | C33H33F2O8S2+ |
| Molecular Weight | 659.75 g/mol |
| Exact Mass | 659.16 |
| IUPAC Name | 2,2-difluoro-2-[2-(4-oxoadamantane-1-carbonyl)oxyacetyl]oxyethanesulfonic acid;triphenylsulfanium |
| SMILES | O=C(COC(=O)C12CC3CC(C1)C(=O)C(C3)C2)OC(F)(F)CS(=O)(=O)O.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C15H18F2O8S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;16-15(17,7-26(21,22)23)25-11(18)6-24-13(20)14-3-8-1-9(4-14)12(19)10(2-8)5-14/h1-15H;8-10H,1-7H2,(H,21,22,23)/q+1; |
| InChIKey | ARVBRBGUDUPDHV-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.75 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|