C29H27O3S+ — CID 171721614
[4-[(4-oxo-1-adamantyl)oxycarbonyl]phenyl]-diphenylsulfanium (PubChem CID 171721614) has the molecular formula C29H27O3S+ and a molecular weight of 455.60 g/mol. Its IUPAC name is [4-[(4-oxo-1-adamantyl)oxycarbonyl]phenyl]-diphenylsulfanium.
| Compound Name | [4-[(4-oxo-1-adamantyl)oxycarbonyl]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 171721614 |
| Molecular Formula | C29H27O3S+ |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | [4-[(4-oxo-1-adamantyl)oxycarbonyl]phenyl]-diphenylsulfanium |
| SMILES | O=C(OC12CC3CC(C1)C(=O)C(C3)C2)c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H27O3S/c30-27-22-15-20-16-23(27)19-29(17-20,18-22)32-28(31)21-11-13-26(14-12-21)33(24-7-3-1-4-8-24)25-9-5-2-6-10-25/h1-14,20,22-23H,15-19H2/q+1 |
| InChIKey | LJTUCVHEANKYPQ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|