C32H33O3S3+ — CID 58108100
[4-(2-oxo-2-spiro[1,3-dithiolane-2,4'-adamantane]-1'-yloxyethoxy)phenyl]-diphenylsulfanium (PubChem CID 58108100) has the molecular formula C32H33O3S3+ and a molecular weight of 561.81 g/mol. Its IUPAC name is [4-(2-oxo-2-spiro[1,3-dithiolane-2,4'-adamantane]-1'-yloxyethoxy)phenyl]-diphenylsulfanium.
| Compound Name | [4-(2-oxo-2-spiro[1,3-dithiolane-2,4'-adamantane]-1'-yloxyethoxy)phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 58108100 |
| Molecular Formula | C32H33O3S3+ |
| Molecular Weight | 561.81 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | [4-(2-oxo-2-spiro[1,3-dithiolane-2,4'-adamantane]-1'-yloxyethoxy)phenyl]-diphenylsulfanium |
| SMILES | O=C(COc1ccc([S+](c2ccccc2)c2ccccc2)cc1)OC12CC3CC(C1)C1(SCCS1)C(C3)C2 |
| InChI | InChI=1S/C32H33O3S3/c33-30(35-31-19-23-17-24(20-31)32(25(18-23)21-31)36-15-16-37-32)22-34-26-11-13-29(14-12-26)38(27-7-3-1-4-8-27)28-9-5-2-6-10-28/h1-14,23-25H,15-22H2/q+1 |
| InChIKey | MQBFLCSFGIJDNB-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.81 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|