C39H37O3S+ — CID 163785050
1-adamantyl 2-[4-[2-(4-dibenzothiophen-5-ium-5-ylphenyl)cyclopropyl]phenoxy]acetate (PubChem CID 163785050) has the molecular formula C39H37O3S+ and a molecular weight of 585.79 g/mol. Its IUPAC name is 1-adamantyl 2-[4-[2-(4-dibenzothiophen-5-ium-5-ylphenyl)cyclopropyl]phenoxy]acetate.
| Compound Name | 1-adamantyl 2-[4-[2-(4-dibenzothiophen-5-ium-5-ylphenyl)cyclopropyl]phenoxy]acetate |
|---|---|
| PubChem CID | 163785050 |
| Molecular Formula | C39H37O3S+ |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | 1-adamantyl 2-[4-[2-(4-dibenzothiophen-5-ium-5-ylphenyl)cyclopropyl]phenoxy]acetate |
| SMILES | O=C(COc1ccc(C2CC2c2ccc(-[s+]3c4ccccc4c4ccccc43)cc2)cc1)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C39H37O3S/c40-38(42-39-21-25-17-26(22-39)19-27(18-25)23-39)24-41-30-13-9-28(10-14-30)34-20-35(34)29-11-15-31(16-12-29)43-36-7-3-1-5-32(36)33-6-2-4-8-37(33)43/h1-16,25-27,34-35H,17-24H2/q+1 |
| InChIKey | MRUVHRRVEKMJCB-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|