C33H25O7S+ — CID 163805094
[(2R)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl] 2-[4-(4-dibenzothiophen-5-ium-5-ylphenoxy)phenoxy]acetate (PubChem CID 163805094) has the molecular formula C33H25O7S+ and a molecular weight of 565.62 g/mol. Its IUPAC name is [(2R)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl] 2-[4-(4-dibenzothiophen-5-ium-5-ylphenoxy)phenoxy]acetate.
| Compound Name | [(2R)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl] 2-[4-(4-dibenzothiophen-5-ium-5-ylphenoxy)phenoxy]acetate |
|---|---|
| PubChem CID | 163805094 |
| Molecular Formula | C33H25O7S+ |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | [(2R)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl] 2-[4-(4-dibenzothiophen-5-ium-5-ylphenoxy)phenoxy]acetate |
| SMILES | O=C(COc1ccc(Oc2ccc(-[s+]3c4ccccc4c4ccccc43)cc2)cc1)O[C@@H]1C2CC3C(=O)OC1C3O2 |
| InChI | InChI=1S/C33H25O7S/c34-29(39-31-26-17-25-30(38-26)32(31)40-33(25)35)18-36-19-9-11-20(12-10-19)37-21-13-15-22(16-14-21)41-27-7-3-1-5-23(27)24-6-2-4-8-28(24)41/h1-16,25-26,30-32H,17-18H2/q+1/t25?,26?,30?,31-,32?/m1/s1 |
| InChIKey | NIIPVOSVLVZIKA-QZTDWGIFSA-N |
| XLogP | 6.53 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|