C26H21O5S+ — CID 171721641
[4-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]phenyl]-diphenylsulfanium (PubChem CID 171721641) has the molecular formula C26H21O5S+ and a molecular weight of 445.52 g/mol. Its IUPAC name is [4-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]phenyl]-diphenylsulfanium.
| Compound Name | [4-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 171721641 |
| Molecular Formula | C26H21O5S+ |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | [4-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]phenyl]-diphenylsulfanium |
| SMILES | O=C(OC1C2CC3C(=O)OC1C3O2)c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21O5S/c27-25(30-23-21-15-20-22(29-21)24(23)31-26(20)28)16-11-13-19(14-12-16)32(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,20-24H,15H2/q+1 |
| InChIKey | HAJHTDMAYPLYHL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|