C11H9F4O8S- — CID 140639455
1,1,2,2-tetrafluoro-4-oxo-4-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]butane-1-sulfonate (PubChem CID 140639455) has the molecular formula C11H9F4O8S- and a molecular weight of 377.24 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-oxo-4-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]butane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-4-oxo-4-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]butane-1-sulfonate |
|---|---|
| PubChem CID | 140639455 |
| Molecular Formula | C11H9F4O8S- |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-oxo-4-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]butane-1-sulfonate |
| SMILES | O=C(CC(F)(F)C(F)(F)S(=O)(=O)[O-])OC1C2CC3C(=O)OC1C3O2 |
| InChI | InChI=1S/C11H10F4O8S/c12-10(13,11(14,15)24(18,19)20)2-5(16)22-7-4-1-3-6(21-4)8(7)23-9(3)17/h3-4,6-8H,1-2H2,(H,18,19,20)/p-1 |
| InChIKey | QQHZRZRVGXFXLO-UHFFFAOYSA-M |
| XLogP | -0.23 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|