C13H17IO5 — CID 148987769
(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2-iodo-2,3-dimethylbutanoate (PubChem CID 148987769) has the molecular formula C13H17IO5 and a molecular weight of 380.18 g/mol. Its IUPAC name is (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2-iodo-2,3-dimethylbutanoate.
| Compound Name | (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2-iodo-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 148987769 |
| Molecular Formula | C13H17IO5 |
| Molecular Weight | 380.18 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2-iodo-2,3-dimethylbutanoate |
| SMILES | CC(C)C(C)(I)C(=O)OC1C2CC3C(=O)OC1C3O2 |
| InChI | InChI=1S/C13H17IO5/c1-5(2)13(3,14)12(16)19-9-7-4-6-8(17-7)10(9)18-11(6)15/h5-10H,4H2,1-3H3 |
| InChIKey | XHOZIDXPYJRVRQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.18 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|