C12H12O7 — CID 59476787
(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2-methylprop-2-enoate (PubChem CID 59476787) has the molecular formula C12H12O7 and a molecular weight of 268.22 g/mol. Its IUPAC name is (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2-methylprop-2-enoate.
| Compound Name | (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59476787 |
| Molecular Formula | C12H12O7 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(=O)OC1C2CC3C(=O)OC1C3O2 |
| InChI | InChI=1S/C12H12O7/c1-4(2)10(13)19-12(15)18-8-6-3-5-7(16-6)9(8)17-11(5)14/h5-9H,1,3H2,2H3 |
| InChIKey | XUFBHLWUCOGJHH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|