About (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) propanoate
(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) propanoate (PubChem CID 59229022) has the molecular formula C10H12O5
and a molecular weight of 212.20 g/mol. Its IUPAC name is (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) propanoate.
Molecular Properties
| Compound Name | (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) propanoate |
| PubChem CID | 59229022 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) propanoate |
| SMILES | CCC(=O)OC1C2CC3C(=O)OC1C3O2 |
| InChI | InChI=1S/C10H12O5/c1-2-6(11)14-8-5-3-4-7(13-5)9(8)15-10(4)12/h4-5,7-9H,2-3H2,1H3 |
| InChIKey | YJYYHRPYEQISNR-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) propanoate?
The IUPAC name of (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) propanoate (CID 59229022) is (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) propanoate.
What is the SMILES notation for (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) propanoate?
The canonical SMILES for (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) propanoate is CCC(=O)OC1C2CC3C(=O)OC1C3O2.
What is the InChIKey of (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) propanoate?
The InChIKey is YJYYHRPYEQISNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O5/c1-2-6(11)14-8-5-3-4-7(13-5)9(8)15-10(4)12/h4-5,7-9H,2-3H2,1H3.
What are the key properties of (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) propanoate?
(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) propanoate has a molecular weight of 212.20 g/mol, XLogP of 0.02, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) propanoate is sourced from PubChem (CID 59229022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).