C14H8F4O8S — CID 176874314
2,3,5,6-tetrafluoro-4-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]benzenesulfonic acid (PubChem CID 176874314) has the molecular formula C14H8F4O8S and a molecular weight of 412.27 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]benzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 176874314 |
| Molecular Formula | C14H8F4O8S |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]benzenesulfonic acid |
| SMILES | O=C(OC1C2CC3C(=O)OC1C3O2)c1c(F)c(F)c(S(=O)(=O)O)c(F)c1F |
| InChI | InChI=1S/C14H8F4O8S/c15-5-4(6(16)8(18)12(7(5)17)27(21,22)23)14(20)25-10-3-1-2-9(24-3)11(10)26-13(2)19/h2-3,9-11H,1H2,(H,21,22,23) |
| InChIKey | WFRRQWUILLVVFF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|