C23H31O3S+ — CID 153282769
(2-methyl-2-adamantyl) 2-[4-(thiolan-1-ium-1-yl)phenoxy]acetate (PubChem CID 153282769) has the molecular formula C23H31O3S+ and a molecular weight of 387.57 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 2-[4-(thiolan-1-ium-1-yl)phenoxy]acetate.
| Compound Name | (2-methyl-2-adamantyl) 2-[4-(thiolan-1-ium-1-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 153282769 |
| Molecular Formula | C23H31O3S+ |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (2-methyl-2-adamantyl) 2-[4-(thiolan-1-ium-1-yl)phenoxy]acetate |
| SMILES | CC1(OC(=O)COc2ccc([S+]3CCCC3)cc2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C23H31O3S/c1-23(18-11-16-10-17(13-18)14-19(23)12-16)26-22(24)15-25-20-4-6-21(7-5-20)27-8-2-3-9-27/h4-7,16-19H,2-3,8-15H2,1H3/q+1 |
| InChIKey | LHEFPOTWQMBPAQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|