About (2-methyl-2-adamantyl) 2-[2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate
(2-methyl-2-adamantyl) 2-[2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate (PubChem CID 153282804) has the molecular formula C25H35O3S+
and a molecular weight of 415.62 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 2-[2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate.
Molecular Properties
| Compound Name | (2-methyl-2-adamantyl) 2-[2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate |
| PubChem CID | 153282804 |
| Molecular Formula | C25H35O3S+ |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | (2-methyl-2-adamantyl) 2-[2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate |
| SMILES | Cc1cc([S+]2CCCC2)cc(C)c1OCC(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C25H35O3S/c1-16-8-22(29-6-4-5-7-29)9-17(2)24(16)27-15-23(26)28-25(3)20-11-18-10-19(13-20)14-21(25)12-18/h8-9,18-21H,4-7,10-15H2,1-3H3/q+1 |
| InChIKey | BVFIMGLXINCJPV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-2-adamantyl) 2-[2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2-adamantyl) 2-[2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate?
The IUPAC name of (2-methyl-2-adamantyl) 2-[2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate (CID 153282804) is (2-methyl-2-adamantyl) 2-[2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate.
What is the SMILES notation for (2-methyl-2-adamantyl) 2-[2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate?
The canonical SMILES for (2-methyl-2-adamantyl) 2-[2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate is Cc1cc([S+]2CCCC2)cc(C)c1OCC(=O)OC1(C)C2CC3CC(C2)CC1C3.
What is the InChIKey of (2-methyl-2-adamantyl) 2-[2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate?
The InChIKey is BVFIMGLXINCJPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35O3S/c1-16-8-22(29-6-4-5-7-29)9-17(2)24(16)27-15-23(26)28-25(3)20-11-18-10-19(13-20)14-21(25)12-18/h8-9,18-21H,4-7,10-15H2,1-3H3/q+1.
What are the key properties of (2-methyl-2-adamantyl) 2-[2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate?
(2-methyl-2-adamantyl) 2-[2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate has a molecular weight of 415.62 g/mol, XLogP of 5.21, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2-adamantyl) 2-[2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate is sourced from PubChem (CID 153282804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).