C26H31F2O3S+ — CID 169017745
[1-(3,4-difluorophenyl)cyclopentyl] 2-[2,6-dimethyl-4-(thian-1-ium-1-yl)phenoxy]acetate (PubChem CID 169017745) has the molecular formula C26H31F2O3S+ and a molecular weight of 461.59 g/mol. Its IUPAC name is [1-(3,4-difluorophenyl)cyclopentyl] 2-[2,6-dimethyl-4-(thian-1-ium-1-yl)phenoxy]acetate.
| Compound Name | [1-(3,4-difluorophenyl)cyclopentyl] 2-[2,6-dimethyl-4-(thian-1-ium-1-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 169017745 |
| Molecular Formula | C26H31F2O3S+ |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | [1-(3,4-difluorophenyl)cyclopentyl] 2-[2,6-dimethyl-4-(thian-1-ium-1-yl)phenoxy]acetate |
| SMILES | Cc1cc([S+]2CCCCC2)cc(C)c1OCC(=O)OC1(c2ccc(F)c(F)c2)CCCC1 |
| InChI | InChI=1S/C26H31F2O3S/c1-18-14-21(32-12-6-3-7-13-32)15-19(2)25(18)30-17-24(29)31-26(10-4-5-11-26)20-8-9-22(27)23(28)16-20/h8-9,14-16H,3-7,10-13,17H2,1-2H3/q+1 |
| InChIKey | VGTMWUBBPMVBTG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|