C27H26FO3S+ — CID 169017430
[1-(3-fluorophenyl)cyclopentyl] 2-[4-(3-ethynylthiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate (PubChem CID 169017430) has the molecular formula C27H26FO3S+ and a molecular weight of 449.57 g/mol. Its IUPAC name is [1-(3-fluorophenyl)cyclopentyl] 2-[4-(3-ethynylthiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate.
| Compound Name | [1-(3-fluorophenyl)cyclopentyl] 2-[4-(3-ethynylthiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate |
|---|---|
| PubChem CID | 169017430 |
| Molecular Formula | C27H26FO3S+ |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | [1-(3-fluorophenyl)cyclopentyl] 2-[4-(3-ethynylthiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate |
| SMILES | C#Cc1cc[s+](-c2cc(C)c(OCC(=O)OC3(c4cccc(F)c4)CCCC3)c(C)c2)c1 |
| InChI | InChI=1S/C27H26FO3S/c1-4-21-10-13-32(18-21)24-14-19(2)26(20(3)15-24)30-17-25(29)31-27(11-5-6-12-27)22-8-7-9-23(28)16-22/h1,7-10,13-16,18H,5-6,11-12,17H2,2-3H3/q+1 |
| InChIKey | RNOQLVCIYWFRCP-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|