C24H29O3S+ — CID 169051309
(4-cyclopentyl-2-methylbut-3-yn-2-yl) 2-(2,6-dimethyl-4-thiophen-1-ium-1-ylphenoxy)acetate (PubChem CID 169051309) has the molecular formula C24H29O3S+ and a molecular weight of 397.56 g/mol. Its IUPAC name is (4-cyclopentyl-2-methylbut-3-yn-2-yl) 2-(2,6-dimethyl-4-thiophen-1-ium-1-ylphenoxy)acetate.
| Compound Name | (4-cyclopentyl-2-methylbut-3-yn-2-yl) 2-(2,6-dimethyl-4-thiophen-1-ium-1-ylphenoxy)acetate |
|---|---|
| PubChem CID | 169051309 |
| Molecular Formula | C24H29O3S+ |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (4-cyclopentyl-2-methylbut-3-yn-2-yl) 2-(2,6-dimethyl-4-thiophen-1-ium-1-ylphenoxy)acetate |
| SMILES | Cc1cc(-[s+]2cccc2)cc(C)c1OCC(=O)OC(C)(C)C#CC1CCCC1 |
| InChI | InChI=1S/C24H29O3S/c1-18-15-21(28-13-7-8-14-28)16-19(2)23(18)26-17-22(25)27-24(3,4)12-11-20-9-5-6-10-20/h7-8,13-16,20H,5-6,9-10,17H2,1-4H3/q+1 |
| InChIKey | WQMFAVYSHCOIFV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|