C31H28F3O3S2+ — CID 169051090
[2-methyl-4-[4-(trifluoromethylsulfanyl)phenyl]but-3-yn-2-yl] 2-[2,6-dimethyl-4-(3-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate (PubChem CID 169051090) has the molecular formula C31H28F3O3S2+ and a molecular weight of 569.69 g/mol. Its IUPAC name is [2-methyl-4-[4-(trifluoromethylsulfanyl)phenyl]but-3-yn-2-yl] 2-[2,6-dimethyl-4-(3-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate.
| Compound Name | [2-methyl-4-[4-(trifluoromethylsulfanyl)phenyl]but-3-yn-2-yl] 2-[2,6-dimethyl-4-(3-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 169051090 |
| Molecular Formula | C31H28F3O3S2+ |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | [2-methyl-4-[4-(trifluoromethylsulfanyl)phenyl]but-3-yn-2-yl] 2-[2,6-dimethyl-4-(3-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate |
| SMILES | Cc1cc(-[s+]2cc(C)c3ccccc32)cc(C)c1OCC(=O)OC(C)(C)C#Cc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C31H28F3O3S2/c1-20-16-25(39-19-22(3)26-8-6-7-9-27(26)39)17-21(2)29(20)36-18-28(35)37-30(4,5)15-14-23-10-12-24(13-11-23)38-31(32,33)34/h6-13,16-17,19H,18H2,1-5H3/q+1 |
| InChIKey | MPEMAELROZJJHU-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|