C30H27O3S+ — CID 169017826
2-naphthalen-1-ylpropan-2-yl 2-[4-(3-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate (PubChem CID 169017826) has the molecular formula C30H27O3S+ and a molecular weight of 467.61 g/mol. Its IUPAC name is 2-naphthalen-1-ylpropan-2-yl 2-[4-(3-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate.
| Compound Name | 2-naphthalen-1-ylpropan-2-yl 2-[4-(3-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 169017826 |
| Molecular Formula | C30H27O3S+ |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 2-naphthalen-1-ylpropan-2-yl 2-[4-(3-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate |
| SMILES | Cc1c[s+](-c2ccc(OCC(=O)OC(C)(C)c3cccc4ccccc34)cc2)c2ccccc12 |
| InChI | InChI=1S/C30H27O3S/c1-21-20-34(28-14-7-6-11-25(21)28)24-17-15-23(16-18-24)32-19-29(31)33-30(2,3)27-13-8-10-22-9-4-5-12-26(22)27/h4-18,20H,19H2,1-3H3/q+1 |
| InChIKey | VCXRUQPODIAILA-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|