C25H27O3S+ — CID 169017903
2-naphthalen-1-ylpropan-2-yl 2-[4-(thiolan-1-ium-1-yl)phenoxy]acetate (PubChem CID 169017903) has the molecular formula C25H27O3S+ and a molecular weight of 407.56 g/mol. Its IUPAC name is 2-naphthalen-1-ylpropan-2-yl 2-[4-(thiolan-1-ium-1-yl)phenoxy]acetate.
| Compound Name | 2-naphthalen-1-ylpropan-2-yl 2-[4-(thiolan-1-ium-1-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 169017903 |
| Molecular Formula | C25H27O3S+ |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-naphthalen-1-ylpropan-2-yl 2-[4-(thiolan-1-ium-1-yl)phenoxy]acetate |
| SMILES | CC(C)(OC(=O)COc1ccc([S+]2CCCC2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H27O3S/c1-25(2,23-11-7-9-19-8-3-4-10-22(19)23)28-24(26)18-27-20-12-14-21(15-13-20)29-16-5-6-17-29/h3-4,7-15H,5-6,16-18H2,1-2H3/q+1 |
| InChIKey | IPPQBYQSIMAOLV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|