C25H30F3O3S+ — CID 169017875
2-[4-(trifluoromethyl)phenyl]propan-2-yl 2-[2,6-dimethyl-4-(thian-1-ium-1-yl)phenoxy]acetate (PubChem CID 169017875) has the molecular formula C25H30F3O3S+ and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]propan-2-yl 2-[2,6-dimethyl-4-(thian-1-ium-1-yl)phenoxy]acetate.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]propan-2-yl 2-[2,6-dimethyl-4-(thian-1-ium-1-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 169017875 |
| Molecular Formula | C25H30F3O3S+ |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]propan-2-yl 2-[2,6-dimethyl-4-(thian-1-ium-1-yl)phenoxy]acetate |
| SMILES | Cc1cc([S+]2CCCCC2)cc(C)c1OCC(=O)OC(C)(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H30F3O3S/c1-17-14-21(32-12-6-5-7-13-32)15-18(2)23(17)30-16-22(29)31-24(3,4)19-8-10-20(11-9-19)25(26,27)28/h8-11,14-15H,5-7,12-13,16H2,1-4H3/q+1 |
| InChIKey | MLMXCAGGVWQMSL-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|