C26H27O3S+ — CID 169017123
2-(4-methylphenyl)propan-2-yl 2-[4-(2-ethynylthiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate (PubChem CID 169017123) has the molecular formula C26H27O3S+ and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-(4-methylphenyl)propan-2-yl 2-[4-(2-ethynylthiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate.
| Compound Name | 2-(4-methylphenyl)propan-2-yl 2-[4-(2-ethynylthiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate |
|---|---|
| PubChem CID | 169017123 |
| Molecular Formula | C26H27O3S+ |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-(4-methylphenyl)propan-2-yl 2-[4-(2-ethynylthiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate |
| SMILES | C#Cc1ccc[s+]1-c1cc(C)c(OCC(=O)OC(C)(C)c2ccc(C)cc2)c(C)c1 |
| InChI | InChI=1S/C26H27O3S/c1-7-22-9-8-14-30(22)23-15-19(3)25(20(4)16-23)28-17-24(27)29-26(5,6)21-12-10-18(2)11-13-21/h1,8-16H,17H2,2-6H3/q+1 |
| InChIKey | ZGECYSLPRORLJH-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|