C33H31O4S+ — CID 169017878
[4-[2-[2-(1-benzofuran-3-yl)propan-2-yloxy]-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium (PubChem CID 169017878) has the molecular formula C33H31O4S+ and a molecular weight of 523.67 g/mol. Its IUPAC name is [4-[2-[2-(1-benzofuran-3-yl)propan-2-yloxy]-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium.
| Compound Name | [4-[2-[2-(1-benzofuran-3-yl)propan-2-yloxy]-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169017878 |
| Molecular Formula | C33H31O4S+ |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | [4-[2-[2-(1-benzofuran-3-yl)propan-2-yloxy]-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1OCC(=O)OC(C)(C)c1coc2ccccc12 |
| InChI | InChI=1S/C33H31O4S/c1-23-19-27(38(25-13-7-5-8-14-25)26-15-9-6-10-16-26)20-24(2)32(23)36-22-31(34)37-33(3,4)29-21-35-30-18-12-11-17-28(29)30/h5-21H,22H2,1-4H3/q+1 |
| InChIKey | AXUSGDSNZRXAEK-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|