C22H23O3S+ — CID 153282711
[4-(2,2-dihydroxyethoxy)-3,5-dimethylphenyl]-diphenylsulfanium (PubChem CID 153282711) has the molecular formula C22H23O3S+ and a molecular weight of 367.49 g/mol. Its IUPAC name is [4-(2,2-dihydroxyethoxy)-3,5-dimethylphenyl]-diphenylsulfanium.
| Compound Name | [4-(2,2-dihydroxyethoxy)-3,5-dimethylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 153282711 |
| Molecular Formula | C22H23O3S+ |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [4-(2,2-dihydroxyethoxy)-3,5-dimethylphenyl]-diphenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1OCC(O)O |
| InChI | InChI=1S/C22H23O3S/c1-16-13-20(14-17(2)22(16)25-15-21(23)24)26(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-14,21,23-24H,15H2,1-2H3/q+1 |
| InChIKey | JVTJGHYLHKAFDY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|