C23H24O4S2 — CID 140669464
3-(4-diphenylsulfonio-2,6-dimethylphenoxy)propane-1-sulfonate (PubChem CID 140669464) has the molecular formula C23H24O4S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 3-(4-diphenylsulfonio-2,6-dimethylphenoxy)propane-1-sulfonate.
| Compound Name | 3-(4-diphenylsulfonio-2,6-dimethylphenoxy)propane-1-sulfonate |
|---|---|
| PubChem CID | 140669464 |
| Molecular Formula | C23H24O4S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 3-(4-diphenylsulfonio-2,6-dimethylphenoxy)propane-1-sulfonate |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1OCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C23H24O4S2/c1-18-16-22(17-19(2)23(18)27-14-9-15-29(24,25)26)28(20-10-5-3-6-11-20)21-12-7-4-8-13-21/h3-8,10-13,16-17H,9,14-15H2,1-2H3 |
| InChIKey | UZHHMNSPMLPPIO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|