C29H35O3S+ — CID 58481029
[4-[2-(3-ethylpentan-3-yloxy)-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium (PubChem CID 58481029) has the molecular formula C29H35O3S+ and a molecular weight of 463.66 g/mol. Its IUPAC name is [4-[2-(3-ethylpentan-3-yloxy)-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium.
| Compound Name | [4-[2-(3-ethylpentan-3-yloxy)-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 58481029 |
| Molecular Formula | C29H35O3S+ |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | [4-[2-(3-ethylpentan-3-yloxy)-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium |
| SMILES | CCC(CC)(CC)OC(=O)COc1c(C)cc([S+](c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C29H35O3S/c1-6-29(7-2,8-3)32-27(30)21-31-28-22(4)19-26(20-23(28)5)33(24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-20H,6-8,21H2,1-5H3/q+1 |
| InChIKey | JPFISRUJEWKYNB-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|