C28H31O4S+ — CID 163526354
[4-[2-[(3-ethyloxetan-3-yl)methoxy]-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium (PubChem CID 163526354) has the molecular formula C28H31O4S+ and a molecular weight of 463.62 g/mol. Its IUPAC name is [4-[2-[(3-ethyloxetan-3-yl)methoxy]-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium.
| Compound Name | [4-[2-[(3-ethyloxetan-3-yl)methoxy]-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 163526354 |
| Molecular Formula | C28H31O4S+ |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | [4-[2-[(3-ethyloxetan-3-yl)methoxy]-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium |
| SMILES | CCC1(COC(=O)COc2c(C)cc([S+](c3ccccc3)c3ccccc3)cc2C)COC1 |
| InChI | InChI=1S/C28H31O4S/c1-4-28(18-30-19-28)20-32-26(29)17-31-27-21(2)15-25(16-22(27)3)33(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-16H,4,17-20H2,1-3H3/q+1 |
| InChIKey | DPCMAGQGVVYAOR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|