C35H41O3S+ — CID 176780257
[3,5-dimethyl-4-[2-[(4-methyl-4-tricyclo[4.4.1.13,8]dodecanyl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium (PubChem CID 176780257) has the molecular formula C35H41O3S+ and a molecular weight of 541.78 g/mol. Its IUPAC name is [3,5-dimethyl-4-[2-[(4-methyl-4-tricyclo[4.4.1.13,8]dodecanyl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [3,5-dimethyl-4-[2-[(4-methyl-4-tricyclo[4.4.1.13,8]dodecanyl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 176780257 |
| Molecular Formula | C35H41O3S+ |
| Molecular Weight | 541.78 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | [3,5-dimethyl-4-[2-[(4-methyl-4-tricyclo[4.4.1.13,8]dodecanyl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1OCC(=O)OC1(C)CC2CC3CCC(C2)CC1C3 |
| InChI | InChI=1S/C35H41O3S/c1-24-16-32(39(30-10-6-4-7-11-30)31-12-8-5-9-13-31)17-25(2)34(24)37-23-33(36)38-35(3)22-28-18-26-14-15-27(19-28)21-29(35)20-26/h4-13,16-17,26-29H,14-15,18-23H2,1-3H3/q+1 |
| InChIKey | WTGCXUFPAUUGKV-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.78 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|