C32H39O6S+ — CID 164717689
bis[3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-phenylsulfanium (PubChem CID 164717689) has the molecular formula C32H39O6S+ and a molecular weight of 551.73 g/mol. Its IUPAC name is bis[3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-phenylsulfanium.
| Compound Name | bis[3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 164717689 |
| Molecular Formula | C32H39O6S+ |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | bis[3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-phenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2cc(C)c(OC(=O)OC(C)(C)C)c(C)c2)cc(C)c1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H39O6S/c1-20-16-25(17-21(2)27(20)35-29(33)37-31(5,6)7)39(24-14-12-11-13-15-24)26-18-22(3)28(23(4)19-26)36-30(34)38-32(8,9)10/h11-19H,1-10H3/q+1 |
| InChIKey | AAHOGEGYKRPCNR-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|