C42H57O9S+ — CID 164717685
tris[3,5-dimethyl-4-(2-methylbutan-2-yloxycarbonyloxy)phenyl]sulfanium (PubChem CID 164717685) has the molecular formula C42H57O9S+ and a molecular weight of 737.98 g/mol. Its IUPAC name is tris[3,5-dimethyl-4-(2-methylbutan-2-yloxycarbonyloxy)phenyl]sulfanium.
| Compound Name | tris[3,5-dimethyl-4-(2-methylbutan-2-yloxycarbonyloxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 164717685 |
| Molecular Formula | C42H57O9S+ |
| Molecular Weight | 737.98 g/mol |
| Exact Mass | 737.37 |
| IUPAC Name | tris[3,5-dimethyl-4-(2-methylbutan-2-yloxycarbonyloxy)phenyl]sulfanium |
| SMILES | CCC(C)(C)OC(=O)Oc1c(C)cc([S+](c2cc(C)c(OC(=O)OC(C)(C)CC)c(C)c2)c2cc(C)c(OC(=O)OC(C)(C)CC)c(C)c2)cc1C |
| InChI | InChI=1S/C42H57O9S/c1-16-40(10,11)49-37(43)46-34-25(4)19-31(20-26(34)5)52(32-21-27(6)35(28(7)22-32)47-38(44)50-41(12,13)17-2)33-23-29(8)36(30(9)24-33)48-39(45)51-42(14,15)18-3/h19-24H,16-18H2,1-15H3/q+1 |
| InChIKey | PLQKFERGWIIVOR-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.98 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|