C30H28FO3S+ — CID 169017415
[4-[2-(4-fluorophenyl)propan-2-yloxycarbonyloxy]-3,5-dimethylphenyl]-diphenylsulfanium (PubChem CID 169017415) has the molecular formula C30H28FO3S+ and a molecular weight of 487.62 g/mol. Its IUPAC name is [4-[2-(4-fluorophenyl)propan-2-yloxycarbonyloxy]-3,5-dimethylphenyl]-diphenylsulfanium.
| Compound Name | [4-[2-(4-fluorophenyl)propan-2-yloxycarbonyloxy]-3,5-dimethylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169017415 |
| Molecular Formula | C30H28FO3S+ |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | [4-[2-(4-fluorophenyl)propan-2-yloxycarbonyloxy]-3,5-dimethylphenyl]-diphenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1OC(=O)OC(C)(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H28FO3S/c1-21-19-27(35(25-11-7-5-8-12-25)26-13-9-6-10-14-26)20-22(2)28(21)33-29(32)34-30(3,4)23-15-17-24(31)18-16-23/h5-20H,1-4H3/q+1 |
| InChIKey | LYIVFVBRJWTBTL-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|