C28H20F5O3S+ — CID 169017070
bis(3,5-difluorophenyl)-[4-[2-(4-fluorophenyl)propan-2-yloxycarbonyloxy]phenyl]sulfanium (PubChem CID 169017070) has the molecular formula C28H20F5O3S+ and a molecular weight of 531.52 g/mol. Its IUPAC name is bis(3,5-difluorophenyl)-[4-[2-(4-fluorophenyl)propan-2-yloxycarbonyloxy]phenyl]sulfanium.
| Compound Name | bis(3,5-difluorophenyl)-[4-[2-(4-fluorophenyl)propan-2-yloxycarbonyloxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 169017070 |
| Molecular Formula | C28H20F5O3S+ |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | bis(3,5-difluorophenyl)-[4-[2-(4-fluorophenyl)propan-2-yloxycarbonyloxy]phenyl]sulfanium |
| SMILES | CC(C)(OC(=O)Oc1ccc([S+](c2cc(F)cc(F)c2)c2cc(F)cc(F)c2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H20F5O3S/c1-28(2,17-3-5-18(29)6-4-17)36-27(34)35-23-7-9-24(10-8-23)37(25-13-19(30)11-20(31)14-25)26-15-21(32)12-22(33)16-26/h3-16H,1-2H3/q+1 |
| InChIKey | WGCRDUZGHWOLEM-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|