C28H23F2O2S+ — CID 169017403
[3-[2-(3,5-difluorophenyl)propan-2-yloxycarbonyl]phenyl]-diphenylsulfanium (PubChem CID 169017403) has the molecular formula C28H23F2O2S+ and a molecular weight of 461.55 g/mol. Its IUPAC name is [3-[2-(3,5-difluorophenyl)propan-2-yloxycarbonyl]phenyl]-diphenylsulfanium.
| Compound Name | [3-[2-(3,5-difluorophenyl)propan-2-yloxycarbonyl]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169017403 |
| Molecular Formula | C28H23F2O2S+ |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | [3-[2-(3,5-difluorophenyl)propan-2-yloxycarbonyl]phenyl]-diphenylsulfanium |
| SMILES | CC(C)(OC(=O)c1cccc([S+](c2ccccc2)c2ccccc2)c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C28H23F2O2S/c1-28(2,21-17-22(29)19-23(30)18-21)32-27(31)20-10-9-15-26(16-20)33(24-11-5-3-6-12-24)25-13-7-4-8-14-25/h3-19H,1-2H3/q+1 |
| InChIKey | DJRQOXSUMATMJT-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|