C29H29O2S+ — CID 169017660
[3-[2-(2-bicyclo[2.2.1]hept-5-enyl)propan-2-yloxycarbonyl]phenyl]-diphenylsulfanium (PubChem CID 169017660) has the molecular formula C29H29O2S+ and a molecular weight of 441.62 g/mol. Its IUPAC name is [3-[2-(2-bicyclo[2.2.1]hept-5-enyl)propan-2-yloxycarbonyl]phenyl]-diphenylsulfanium.
| Compound Name | [3-[2-(2-bicyclo[2.2.1]hept-5-enyl)propan-2-yloxycarbonyl]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169017660 |
| Molecular Formula | C29H29O2S+ |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | [3-[2-(2-bicyclo[2.2.1]hept-5-enyl)propan-2-yloxycarbonyl]phenyl]-diphenylsulfanium |
| SMILES | CC(C)(OC(=O)c1cccc([S+](c2ccccc2)c2ccccc2)c1)C1CC2C=CC1C2 |
| InChI | InChI=1S/C29H29O2S/c1-29(2,27-19-21-16-17-22(27)18-21)31-28(30)23-10-9-15-26(20-23)32(24-11-5-3-6-12-24)25-13-7-4-8-14-25/h3-17,20-22,27H,18-19H2,1-2H3/q+1 |
| InChIKey | BTZSMNMNTKRLKD-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|