C23H17F6O3S+ — CID 171589936
diphenyl-[3-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]carbonylphenyl]sulfanium (PubChem CID 171589936) has the molecular formula C23H17F6O3S+ and a molecular weight of 487.44 g/mol. Its IUPAC name is diphenyl-[3-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]carbonylphenyl]sulfanium.
| Compound Name | diphenyl-[3-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]carbonylphenyl]sulfanium |
|---|---|
| PubChem CID | 171589936 |
| Molecular Formula | C23H17F6O3S+ |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | diphenyl-[3-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]carbonylphenyl]sulfanium |
| SMILES | O=C(OCC(O)(C(F)(F)F)C(F)(F)F)c1cccc([S+](c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H17F6O3S/c24-22(25,26)21(31,23(27,28)29)15-32-20(30)16-8-7-13-19(14-16)33(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-14,31H,15H2/q+1 |
| InChIKey | VSGSGRDIGCXCCA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|