C28H19F6O3S+ — CID 171721777
[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]carbonylphenyl]-diphenylsulfanium (PubChem CID 171721777) has the molecular formula C28H19F6O3S+ and a molecular weight of 549.51 g/mol. Its IUPAC name is [3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]carbonylphenyl]-diphenylsulfanium.
| Compound Name | [3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]carbonylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 171721777 |
| Molecular Formula | C28H19F6O3S+ |
| Molecular Weight | 549.51 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | [3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]carbonylphenyl]-diphenylsulfanium |
| SMILES | O=C(Oc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)c1cccc([S+](c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H19F6O3S/c29-27(30,31)26(36,28(32,33)34)20-14-16-21(17-15-20)37-25(35)19-8-7-13-24(18-19)38(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-18,36H/q+1 |
| InChIKey | KCWKFBZPCDRDCP-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.51 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|