C29H27O2S+ — CID 169017873
2-(2-bicyclo[2.2.1]hept-5-enyl)propan-2-yl 4-dibenzothiophen-5-ium-5-ylbenzoate (PubChem CID 169017873) has the molecular formula C29H27O2S+ and a molecular weight of 439.60 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enyl)propan-2-yl 4-dibenzothiophen-5-ium-5-ylbenzoate.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)propan-2-yl 4-dibenzothiophen-5-ium-5-ylbenzoate |
|---|---|
| PubChem CID | 169017873 |
| Molecular Formula | C29H27O2S+ |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)propan-2-yl 4-dibenzothiophen-5-ium-5-ylbenzoate |
| SMILES | CC(C)(OC(=O)c1ccc(-[s+]2c3ccccc3c3ccccc32)cc1)C1CC2C=CC1C2 |
| InChI | InChI=1S/C29H27O2S/c1-29(2,25-18-19-11-12-21(25)17-19)31-28(30)20-13-15-22(16-14-20)32-26-9-5-3-7-23(26)24-8-4-6-10-27(24)32/h3-16,19,21,25H,17-18H2,1-2H3/q+1 |
| InChIKey | RUDRLLXNXKVUTF-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|