C37H43FO5S — CID 161388357
4-fluorobenzoate;tris[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium (PubChem CID 161388357) has the molecular formula C37H43FO5S and a molecular weight of 618.81 g/mol. Its IUPAC name is 4-fluorobenzoate;tris[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium.
| Compound Name | 4-fluorobenzoate;tris[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 161388357 |
| Molecular Formula | C37H43FO5S |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 4-fluorobenzoate;tris[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium |
| SMILES | CC(C)(C)Oc1ccc([S+](c2ccc(OC(C)(C)C)cc2)c2ccc(OC(C)(C)C)cc2)cc1.O=C([O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C30H39O3S.C7H5FO2/c1-28(2,3)31-22-10-16-25(17-11-22)34(26-18-12-23(13-19-26)32-29(4,5)6)27-20-14-24(15-21-27)33-30(7,8)9;8-6-3-1-5(2-4-6)7(9)10/h10-21H,1-9H3;1-4H,(H,9,10)/q+1;/p-1 |
| InChIKey | VSQLQBVGFVXWKG-UHFFFAOYSA-M |
| XLogP | 8.50 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|