C25H30NO2S+ — CID 23373964
bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-pyridin-4-ylsulfanium (PubChem CID 23373964) has the molecular formula C25H30NO2S+ and a molecular weight of 408.59 g/mol. Its IUPAC name is bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-pyridin-4-ylsulfanium.
| Compound Name | bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-pyridin-4-ylsulfanium |
|---|---|
| PubChem CID | 23373964 |
| Molecular Formula | C25H30NO2S+ |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-pyridin-4-ylsulfanium |
| SMILES | CC(C)(C)Oc1ccc([S+](c2ccncc2)c2ccc(OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H30NO2S/c1-24(2,3)27-19-7-11-21(12-8-19)29(23-15-17-26-18-16-23)22-13-9-20(10-14-22)28-25(4,5)6/h7-18H,1-6H3/q+1 |
| InChIKey | XKPRJAGDPYABCD-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|