C32H36NO3S+ — CID 22290204
bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-[4-(pyridin-4-ylmethoxy)phenyl]sulfanium (PubChem CID 22290204) has the molecular formula C32H36NO3S+ and a molecular weight of 514.71 g/mol. Its IUPAC name is bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-[4-(pyridin-4-ylmethoxy)phenyl]sulfanium.
| Compound Name | bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-[4-(pyridin-4-ylmethoxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 22290204 |
| Molecular Formula | C32H36NO3S+ |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-[4-(pyridin-4-ylmethoxy)phenyl]sulfanium |
| SMILES | CC(C)(C)Oc1ccc([S+](c2ccc(OCc3ccncc3)cc2)c2ccc(OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H36NO3S/c1-31(2,3)35-26-9-15-29(16-10-26)37(30-17-11-27(12-18-30)36-32(4,5)6)28-13-7-25(8-14-28)34-23-24-19-21-33-22-20-24/h7-22H,23H2,1-6H3/q+1 |
| InChIKey | ZZCXYMHLQXBXKZ-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|