C39H43NO6S2 — CID 22290305
bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-[3-(pyridin-4-ylmethoxy)phenyl]sulfanium;4-methylbenzenesulfonate (PubChem CID 22290305) has the molecular formula C39H43NO6S2 and a molecular weight of 685.91 g/mol. Its IUPAC name is bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-[3-(pyridin-4-ylmethoxy)phenyl]sulfanium;4-methylbenzenesulfonate.
| Compound Name | bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-[3-(pyridin-4-ylmethoxy)phenyl]sulfanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 22290305 |
| Molecular Formula | C39H43NO6S2 |
| Molecular Weight | 685.91 g/mol |
| Exact Mass | 685.25 |
| IUPAC Name | bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-[3-(pyridin-4-ylmethoxy)phenyl]sulfanium;4-methylbenzenesulfonate |
| SMILES | CC(C)(C)Oc1ccc([S+](c2ccc(OC(C)(C)C)cc2)c2cccc(OCc3ccncc3)c2)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C32H36NO3S.C7H8O3S/c1-31(2,3)35-25-10-14-28(15-11-25)37(29-16-12-26(13-17-29)36-32(4,5)6)30-9-7-8-27(22-30)34-23-24-18-20-33-21-19-24;1-6-2-4-7(5-3-6)11(8,9)10/h7-22H,23H2,1-6H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | VIXSNWLNGYAITG-UHFFFAOYSA-M |
| XLogP | 9.01 |
| TPSA | 97.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.91 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|