C24H24F2O5S2 — CID 154594394
1,1-difluoro-2-[4-[[4-[(2-methylpropan-2-yl)oxy]phenyl]-phenylsulfonio]phenoxy]ethanesulfonate (PubChem CID 154594394) has the molecular formula C24H24F2O5S2 and a molecular weight of 494.58 g/mol. Its IUPAC name is 1,1-difluoro-2-[4-[[4-[(2-methylpropan-2-yl)oxy]phenyl]-phenylsulfonio]phenoxy]ethanesulfonate.
| Compound Name | 1,1-difluoro-2-[4-[[4-[(2-methylpropan-2-yl)oxy]phenyl]-phenylsulfonio]phenoxy]ethanesulfonate |
|---|---|
| PubChem CID | 154594394 |
| Molecular Formula | C24H24F2O5S2 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 1,1-difluoro-2-[4-[[4-[(2-methylpropan-2-yl)oxy]phenyl]-phenylsulfonio]phenoxy]ethanesulfonate |
| SMILES | CC(C)(C)Oc1ccc([S+](c2ccccc2)c2ccc(OCC(F)(F)S(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H24F2O5S2/c1-23(2,3)31-19-11-15-22(16-12-19)32(20-7-5-4-6-8-20)21-13-9-18(10-14-21)30-17-24(25,26)33(27,28)29/h4-16H,17H2,1-3H3 |
| InChIKey | SVKGGDSKTFMPTQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|