C42H41F3O6S2 — CID 171924546
bis[3-[(2-methylpropan-2-yl)oxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]sulfanium;trifluoromethanesulfonate (PubChem CID 171924546) has the molecular formula C42H41F3O6S2 and a molecular weight of 762.91 g/mol. Its IUPAC name is bis[3-[(2-methylpropan-2-yl)oxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]sulfanium;trifluoromethanesulfonate.
| Compound Name | bis[3-[(2-methylpropan-2-yl)oxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]sulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171924546 |
| Molecular Formula | C42H41F3O6S2 |
| Molecular Weight | 762.91 g/mol |
| Exact Mass | 762.23 |
| IUPAC Name | bis[3-[(2-methylpropan-2-yl)oxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]sulfanium;trifluoromethanesulfonate |
| SMILES | CC(C)(C)Oc1cccc([S+](c2ccc(OCc3cc4ccccc4c4ccccc34)cc2)c2cccc(OC(C)(C)C)c2)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C41H41O3S.CHF3O3S/c1-40(2,3)43-32-14-11-16-35(26-32)45(36-17-12-15-33(27-36)44-41(4,5)6)34-23-21-31(22-24-34)42-28-30-25-29-13-7-8-18-37(29)39-20-10-9-19-38(30)39;2-1(3,4)8(5,6)7/h7-27H,28H2,1-6H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | JBSPEMYDOZUNNK-UHFFFAOYSA-M |
| XLogP | 11.07 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.91 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|