C50H57F3O8S2 — CID 171929909
[4-(anthracen-9-ylmethoxy)phenyl]-bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;trifluoromethanesulfonate (PubChem CID 171929909) has the molecular formula C50H57F3O8S2 and a molecular weight of 907.13 g/mol. Its IUPAC name is [4-(anthracen-9-ylmethoxy)phenyl]-bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;trifluoromethanesulfonate.
| Compound Name | [4-(anthracen-9-ylmethoxy)phenyl]-bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171929909 |
| Molecular Formula | C50H57F3O8S2 |
| Molecular Weight | 907.13 g/mol |
| Exact Mass | 906.34 |
| IUPAC Name | [4-(anthracen-9-ylmethoxy)phenyl]-bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;trifluoromethanesulfonate |
| SMILES | CC(C)(C)Oc1ccc([S+](c2ccc(OCc3c4ccccc4cc4ccccc34)cc2)c2ccc(OC(C)(C)C)c(OC(C)(C)C)c2)cc1OC(C)(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C49H57O5S.CHF3O3S/c1-46(2,3)51-42-27-25-37(30-44(42)53-48(7,8)9)55(38-26-28-43(52-47(4,5)6)45(31-38)54-49(10,11)12)36-23-21-35(22-24-36)50-32-41-39-19-15-13-17-33(39)29-34-18-14-16-20-40(34)41;2-1(3,4)8(5,6)7/h13-31H,32H2,1-12H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | BTEHHEOHVNZNCC-UHFFFAOYSA-M |
| XLogP | 13.43 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.13 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|